
1073-70-7
| Name | 4-Chlorophenylhydrazine hydrochloride |
| CAS | 1073-70-7 |
| EINECS(EC#) | 214-030-9 |
| Molecular Formula | C6H8Cl2N2 |
| MDL Number | MFCD00012943 |
| Molecular Weight | 179.05 |
| MOL File | 1073-70-7.mol |
Chemical Properties
| Appearance | white to pink crystalline powder |
| Melting point | 216 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | White to pink |
| Water Solubility | Soluble in hot water, methanol. |
| BRN | 3596254 |
| InChI | InChI=1S/C6H7ClN2.ClH/c7-5-1-3-6(9-8)4-2-5;/h1-4,9H,8H2;1H |
| InChIKey | YQVZREHUWCCHHX-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(Cl)C=C1)N.[H]Cl |
| CAS DataBase Reference | 1073-70-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| REACH Registrations | Active |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29280090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
