1031-07-8
| Name | ENDOSULFAN SULFATE |
| CAS | 1031-07-8 |
| EINECS(EC#) | 623-765-8 |
| Molecular Formula | C9H6Cl6O4S |
| MDL Number | MFCD00151179 |
| Molecular Weight | 422.92 |
| MOL File | 1031-07-8.mol |
Chemical Properties
| Melting point | 147.71°C |
| Boiling point | 480.7±45.0 °C(Predicted) |
| density | 1.6835 (estimate) |
| vapor pressure | 9.75 x 10-6 mmHg at 25 °C (subcooled liquid vapor pressure calculated from GC retention time data,Hinckley et al., 1990) |
| Fp | -26 °C |
| storage temp. | APPROX 4°C |
| solubility | DMSO: Slightly Soluble,Methanol: Slightly Soluble |
| form | Liquid |
| color | Clear colorless |
| Water Solubility | 117 ppb (Ali, 1978) |
| Henry's Law Constant | 4.64(x 10-5 atm?m3/mol) at 25 °C (approximate - calculated from water solubility and vapor pressure) |
| Major Application | agriculture environmental |
| InChI | 1S/C9H6Cl6O4S/c10-5-6(11)8(13)4-2-19-20(16,17)18-1-3(4)7(5,12)9(8,14)15/h3-4H,1-2H2/t3?,4?,7-,8+ |
| InChIKey | AAPVQEMYVNZIOO-WINLOITPSA-N |
| SMILES | ClC1=C(Cl)[C@]2(Cl)C3COS(=O)(=O)OCC3[C@@]1(Cl)C2(Cl)Cl |
| EPA Substance Registry System | Endosulfan sulfate (1031-07-8) |
Safety Data
| Hazard Codes | T+,N,Xn,F,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2761 |
| WGK Germany | 3 |
| RTECS | RB9150000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 1031-07-8(Hazardous Substances Data) |