
102280-35-3
| Name | BAQUILOPRIM |
| CAS | 102280-35-3 |
| Molecular Formula | C17H20N6 |
| MDL Number | MFCD00864859 |
| Molecular Weight | 308.38 |
| MOL File | 102280-35-3.mol |
Chemical Properties
| Melting point | >215 °C (dec.) |
| Boiling point | 567.9±60.0 °C(Predicted) |
| density | 1.277±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | neat |
| pka | 7.02±0.10(Predicted) |
| color | Pale to Light Yellow |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C17H20N6/c1-10-7-11(8-12-9-21-17(19)22-16(12)18)13-5-4-6-20-14(13)15(10)23(2)3/h4-7,9H,8H2,1-3H3,(H4,18,19,21,22) |
| InChIKey | AIOWJIMWVFWROP-UHFFFAOYSA-N |
| SMILES | CN(C)c1c(C)cc(Cc2cnc(N)nc2N)c3cccnc13 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | UV8142576 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
