101385-69-7
| Name | 2-Chloro-1,3-dimethylimidazolidinium hexafluorophosphate |
| CAS | 101385-69-7 |
| EINECS(EC#) | 628-484-4 |
| Molecular Formula | C5H12ClF6N2P |
| MDL Number | MFCD00191914 |
| Molecular Weight | 280.58 |
| MOL File | 101385-69-7.mol |
Chemical Properties
| Melting point | 231-233 °C (lit.) |
| storage temp. | 2-8°C |
| solubility | acetonitrile: 0.1 g/mL, clear |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture & Light Sensitive |
| BRN | 5369058 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C5H10ClN2.F6P/c1-7-3-4-8(2)5(7)6;1-7(2,3,4,5)6/h3-4H2,1-2H3;/q+1;-1 |
| InChIKey | CNAKHAGVVMOXFE-UHFFFAOYSA-N |
| SMILES | [P-](F)(F)(F)(F)(F)F.C1(Cl)=[N+](C)CCN1C |
| CAS DataBase Reference | 101385-69-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |