| Melting point |
199 °C (dec.)(lit.) |
| Boiling point |
260°C |
| Density |
1.1946 (rough estimate) |
| vapor pressure |
0Pa at 25℃ |
| refractive index |
1.6000 (estimate) |
| storage temp. |
Flammables area |
| solubility |
Insoluble in water; soluble in benzene, methanol, acetone, isopropanol; slightly soluble in ethanol |
| form |
Powder/Solid |
| Colour Index |
26105 |
| pka |
13.52±0.50(Predicted) |
| color |
Red Brown |
| Water Solubility |
23μg/L at 25℃ |
| ε(extinction coefficient) |
≥12000 at 356-360nm in toluene at 0.008g/L
≥26000 at 519-523nm in toluene at 0.008g/L |
| λmax |
520 nm, 357 nm |
| Merck |
14,8393 |
| BRN |
709018 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Biological Applications |
Detecting atherosclerosis; diapers; skin care products; shampoos; hair colors; stents; dental impression materials |
| Major Application |
cleaning products
cosmetics
food and beverages
personal care |
| Cosmetics Ingredients Functions |
COLORANT |
| InChI |
1S/C24H20N4O/c1-16-7-3-6-10-21(16)26-25-19-12-13-22(17(2)15-19)27-28-24-20-9-5-4-8-18(20)11-14-23(24)29/h3-15,29H,1-2H3/b26-25+,28-27+ |
| InChIKey |
RCTGMCJBQGBLKT-PAMTUDGESA-N |
| SMILES |
Cc1ccccc1\N=N\c2ccc(\N=N\c3c(O)ccc4ccccc34)c(C)c2 |
| LogP |
6.66 |
| IARC |
3 (Vol. 8, Sup 7) 1987 |
| NIST Chemistry Reference |
O-tolylazo-o-tolylazo-beta-naphthol(85-83-6) |
| EPA Substance Registry System |
C.I. Solvent Red 24 (85-83-6) |
