| Melting point |
185 °C (dec.)(lit.) |
| Boiling point |
659.5±55.0 °C(Predicted) |
| Density |
1.632±0.06 g/cm3(Predicted) |
| storage temp. |
-20°C Freezer, Under inert atmosphere |
| solubility |
H2O: 1 mg/mL, clear, red |
| pka |
7.21±0.10(Predicted) |
| form |
Metallic or Crystalline Powder |
| color |
Dark red-brown |
| PH Range |
6.0(YELLOW)-7.0(PURPLE)-9.0(PURPLISH RED) |
| Water Solubility |
Soluble in water, ethylene glycol, monomethyl ether and ethanol. |
| BRN |
353938 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
diagnostic assay manufacturing hematology histology |
| InChI |
1S/C19H14O7S/c20-14-7-5-11(9-16(14)22)19(12-6-8-15(21)17(23)10-12)13-3-1-2-4-18(13)27(24,25)26/h1-10,20,22-23H,(H,24,25,26)/b19-12+ |
| InChIKey |
HGPSVOAVAYJEIJ-XDHOZWIPSA-N |
| SMILES |
Oc1ccc(cc1O)C(=C2\C=CC(=O)C(O)=C2)\c3ccccc3S(O)(=O)=O |
| CAS DataBase Reference |
115-41-3(CAS DataBase Reference) |
| EPA Substance Registry System |
1,2-Benzenediol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis- (115-41-3) |