| Melting point |
160–162°C |
| Density |
1.466±0.06 g/cm3(Predicted) |
| vapor pressure |
<1.1 × 10-4 (Pa at 25 °C) |
| storage temp. |
Refrigerator, under inert atmosphere |
| solubility |
Solubility in organic solvents (g/l at 20 °C)
Acetone 20
Ethyl acetate 3.3
Dichloromethane 56
n‐Heptane 0.00023
Methanol 8.3
Xylene 0.13 |
| pka |
Dissociation constant (pKa at 20 °C) Predicted to have five overlapping dissociation constants: ?1.4, 0.7, 3.5, 9.6, 11.5 |
| color |
White to Off-White |
| Water Solubility |
Solubility in water (g/l at 20 °C) 0.026 (pH 4, buffer) 0.63 (pH 7, buffer) 39 (pH 8.5, buffer) |
| BRN |
11343666 |
| Stability |
Moisture Sensitive |
| Major Application |
agriculture
environmental |
| InChI |
1S/C16H20N6O6S/c1-22(2)14(23)10-7-5-6-8-11(10)20-29(25,26)21-16(24)19-15-17-12(27-3)9-13(18-15)28-4/h5-9,20H,1-4H3,(H2,17,18,19,21,24) |
| InChIKey |
UCDPMNSCCRBWIC-UHFFFAOYSA-N |
| SMILES |
COc1cc(OC)nc(NC(=O)NS(=O)(=O)Nc2ccccc2C(=O)N(C)C)n1 |
| LogP |
0.3-2.02 at 20℃ and pH4-9 |
| Surface tension |
71.4mN/m at 37.7mg/L and 22℃ |
| EPA Substance Registry System |
Benzamide, 2-[[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]amino]-N,N-dimethyl- (213464-77-8) |
