| Melting point |
-49°C |
| Boiling point |
126-128 °C12 mm Hg(lit.) |
| Density |
0.945 g/mL at 25 °C(lit.) |
| vapor pressure |
<1 hPa (25 °C) |
| refractive index |
n20/D 1.52(lit.) |
| FEMA |
2595 | BETA-IONONE |
| Flash point |
230 °F |
| storage temp. |
Store below +30°C. |
| solubility |
0.11g/l insoluble |
| form |
Oil |
| color |
Clear Colorless to Light Yellow |
| Odor |
at 10.00 % in dipropylene glycol. dry powdery floral woody orris berry seedy |
| Odor Type |
floral |
| Water Solubility |
Soluble in water (0.11 mg/mI at 20°C). |
| Merck |
14,5056 |
| JECFA Number |
389 |
| BRN |
1909544 |
| Dielectric constant |
12.0（20℃） |
| Stability |
Light Sensitive |
| Major Application |
cleaning products
cosmetics
flavors and fragrances
food and beverages
personal care |
| Cosmetics Ingredients Functions |
PERFUMING
ASTRINGENT |
| InChI |
1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8H,5-6,9H2,1-4H3/b8-7+ |
| InChIKey |
PSQYTAPXSHCGMF-BQYQJAHWSA-N |
| SMILES |
O=C(C)\C=C\C1=C(CCCC1(C)C)C |
| LogP |
4 at 25℃ |
| CAS DataBase Reference |
79-77-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (E)-(79-77-6) |
| EPA Substance Registry System |
.beta.-Ionone (79-77-6) |
