| Melting point |
215 °C (dec.)(lit.) |
| Boiling point |
316.88°C (rough estimate) |
| alpha |
-51.5 º (c=4, 1M HCl, dry sub) |
| Density |
1.1967 (rough estimate) |
| refractive index |
-51.5 ° (C=4, 1mol/L HCl) |
| storage temp. |
2-8°C |
| solubility |
Practically insoluble in water, in ethanol (96 per cent) and in methylene chloride. It dissolves in hydrochloric acid. |
| form |
Fine Crystalline Powder |
| pka |
8.66(at 25℃) |
| color |
White to light beige |
| optical activity |
-53.222～25 (c 1.2, 0.5 mol dm-3 HCl)-50.617 (c 7.5, 0.37 mol dm-3 HCl), L +50.5 (HCl) |
| Water Solubility |
<0.01 g/100 mL at 18 ºC |
| Sensitive |
Air & Light Sensitive |
| Decomposition |
> 212°C |
| Merck |
14,3619 |
| BRN |
2368277 |
| Henry's Law Constant |
1.4×1013 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable. Incompatible with acids, acid chlorides, acid anhydrides, oxidizing agents. Light sensitive. |
| InChI |
1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1 |
| InChIKey |
UCTWMZQNUQWSLP-VIFPVBQESA-N |
| SMILES |
CNC[C@H](O)c1ccc(O)c(O)c1 |
| CAS DataBase Reference |
51-43-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
L-adrenaline(51-43-4) |
| EPA Substance Registry System |
Epinephrine (51-43-4) |
