| Melting point |
206-209 °C |
| alpha |
-36.2 º (c=5, C2H5OH) |
| Boiling point |
210 °C(lit.) |
| Density |
0.8389 (rough estimate) |
| vapor density |
5.31 (vs air) |
| vapor pressure |
33.5 mm Hg ( 25 °C) |
| FEMA |
2157 | BORNEOL |
| refractive index |
-36 ° (C=5, EtOH) |
| Flash point |
150 °F |
| storage temp. |
Store below +30°C. |
| solubility |
almost transparency in EtOH |
| pka |
15.36±0.60(Predicted) |
| form |
Crystalline Powder or Crystals |
| color |
White to light yellow |
| Odor |
at 10.00 % in dipropylene glycol. pine woody camphor |
| Odor Type |
balsamic |
| optical activity |
[α]20/D 35.3°, c = 5 in ethanol |
| Water Solubility |
INSOLUBLE |
| Merck |
14,1338 |
| BRN |
3587558 |
| Major Application |
food and beverages |
| InChI |
1S/C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8+,10+/m0/s1 |
| InChIKey |
DTGKSKDOIYIVQL-QXFUBDJGSA-N |
| SMILES |
CC1(C)[C@H]2CC[C@]1(C)[C@H](O)C2 |
| LogP |
2.75 at 20℃ |
| CAS DataBase Reference |
464-45-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
Bicyclo[2.2.1]heptan-2-ol, 1,7,7-trimethyl-, (1S-endo)-(464-45-9) |
| EPA Substance Registry System |
(-)-Borneol (464-45-9) |
