| Melting point |
<0°C |
| Boiling point |
144-145.5 °C (lit.) |
| Density |
1.562 g/mL at 25 °C (lit.) |
| vapor pressure |
2.8hPa at 25℃ |
| refractive index |
n20/D 1.475(lit.) |
| Flash point |
78°C |
| storage temp. |
below 5° C |
| solubility |
sol CHCl3, CH2Cl2, benzene, THF; reacts violently,
producing toxic fumes, with H2O, alcohols. |
| form |
liquid |
| Specific Gravity |
1.562 |
| color |
Colorless to Almost colorless |
| Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
| Stability |
Stable, but reacts violently with water. Moisture sensitive. May be shock sensitive. Incompatible with water, moisture, acids, strong bases, oxidizing agents, alcohols. |
| InChI |
1S/Cl6Si2/c1-7(2,3)8(4,5)6 |
| InChIKey |
LXEXBJXDGVGRAR-UHFFFAOYSA-N |
| SMILES |
Cl[Si](Cl)(Cl)[Si](Cl)(Cl)Cl |
| CAS DataBase Reference |
13465-77-5(CAS DataBase Reference) |
| EPA Substance Registry System |
Disilane, hexachloro- (13465-77-5) |
