| Melting point |
~205 °C |
| Boiling point |
468.7±45.0 °C(Predicted) |
| Density |
1.499±0.06 g/cm3(Predicted) |
| refractive index |
13 ° (C=2, H2O) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| Water Solubility |
almost transparency in Water |
| form |
powder to crystal |
| pka |
2.92±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]20/D +12.0±2°, c = 5% in H2O |
| BRN |
1727387 |
| Major Application |
peptide synthesis |
| InChI |
1S/C6H10N2O5/c7-2-4(9)8-3(6(12)13)1-5(10)11/h3H,1-2,7H2,(H,8,9)(H,10,11)(H,12,13)/t3-/m0/s1 |
| InChIKey |
SCCPDJAQCXWPTF-VKHMYHEASA-N |
| SMILES |
NCC(=O)N[C@@H](CC(O)=O)C(O)=O |
| CAS DataBase Reference |
4685-12-5(CAS DataBase Reference) |