| Melting point |
290 °C (dec.) (lit.) |
| Boiling point |
260℃[at 101 325 Pa] |
| Density |
0.513[at 20℃] |
| bulk density |
350kg/m3 |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
room temp |
| solubility |
H2O: soluble50mg/mL, clear, colorless to faintly yellow |
| Colour Index |
42053 |
| form |
Powder/Solid |
| color |
Red to Red-Brown |
| PH |
2.7 (10g/l, H2O, 20℃) |
| Odor |
Odorless |
| Water Solubility |
Soluble in water, glycerin, glycol and ethanol. |
| Sensitive |
Hygroscopic |
| λmax |
532 nm |
| Decomposition |
290 °C |
| Merck |
14,3941 |
| BRN |
5718212 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Biological Applications |
Drug delivery and tissue engineering; photodynamic therapy; dental materials; treating cancer,diabetes; wound dressing materials |
| Major Application |
cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions |
COLORANT HAIR DYEING |
| InChIKey |
RZSYLLSAWYUBPE-UHFFFAOYSA-L |
| SMILES |
[Na+].[Na+].CCN(Cc1cccc(c1)S([O-])(=O)=O)c2ccc(cc2)C(=C3/C=CC(\C=C3)=[N+](\CC)Cc4cccc(c4)S([O-])(=O)=O)\c5ccc(O)cc5S([O-])(=O)=O |
| LogP |
-5.42 at 25℃ |
| IARC |
3 (Vol. 16, Sup 7) 1987 |
| EPA Substance Registry System |
C.I. Food Green 3, disodium salt (2353-45-9) |