| Melting point |
5-6 °C(lit.) |
| alpha |
D20 +66.9° |
| Boiling point |
192-194 °C(lit.) |
| Density |
0.948 g/mL at 25 °C(lit.) |
| FEMA |
2479 | D-FENCHONE |
| refractive index |
n20/D 1.461(lit.) |
| Flash point |
127 °F |
| storage temp. |
2-8°C |
| solubility |
Chloroform (Sparingly), Methanol (Slightly) |
| form |
Liquid |
| color |
Clear colorless to pale yellow |
| Odor |
at 100.00 %. camphor thuja cedarleaf herbal earthy woody |
| Odor Type |
balsamic |
| optical activity |
[α]20/D +62±1°, neat |
| Water Solubility |
2.147g/L(25 ºC) |
| Merck |
14,3968 |
| JECFA Number |
1396 |
| BRN |
2206555 |
| Dielectric constant |
12.0(20℃) |
| Major Application |
cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions |
PERFUMING |
| InChI |
1S/C10H16O/c1-9(2)7-4-5-10(3,6-7)8(9)11/h7H,4-6H2,1-3H3/t7-,10+/m1/s1 |
| InChIKey |
LHXDLQBQYFFVNW-XCBNKYQSSA-N |
| SMILES |
CC1(C)[C@@H]2CC[C@@](C)(C2)C1=O |
| LogP |
2.089 (est) |
| EPA Substance Registry System |
Bicyclo[2.2.1]heptan-2-one, 1,3,3-trimethyl-, (1S,4R)- (4695-62-9) |