| Melting point |
~200 °C (dec.)(lit.) |
| Boiling point |
385.06°C (rough estimate) |
| Density |
1.2532 (rough estimate) |
| refractive index |
1.6081 (estimate) |
| storage temp. |
Refrigerator |
| solubility |
Chloroform (Very Slightly, Heated, Sonicated), DMSO (Slightly), Methanol (Slightly) |
| Colour Index |
11005 |
| pka |
2.78±0.10(Predicted) |
| form |
Powder |
| color |
Red to dark brown |
| Water Solubility |
290.7ug/L(25 ºC) |
| λmax |
443 nm |
| BRN |
1842907 |
| Henry's Law Constant |
3.5×104 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| Major Application |
cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions |
HAIR DYEING |
| InChI |
1S/C12H10N4O2/c13-9-1-3-10(4-2-9)14-15-11-5-7-12(8-6-11)16(17)18/h1-8H,13H2/b15-14+ |
| InChIKey |
UNBOSJFEZZJZLR-CCEZHUSRSA-N |
| SMILES |
Nc1ccc(cc1)\N=N\c2ccc(cc2)[N+]([O-])=O |
| CAS DataBase Reference |
730-40-5(CAS DataBase Reference) |
| EPA Substance Registry System |
C.I. Disperse Orange 3 (730-40-5) |