| Melting point |
143-144 °C(lit.) |
| Boiling point |
496.11°C (rough estimate) |
| Density |
1.75 g/cm3 |
| vapor density |
13.2 (vs air) |
| vapor pressure |
30.7 and 58.5 at 20 and 25 °C, respectively (gas saturation-GC, Grayson and Fosbraey, 1982) |
| refractive index |
1.5550 (estimate) |
| Flash point |
2 °C |
| storage temp. |
APPROX 4°C |
| solubility |
Soluble in ethanol and benzene (Weast, 1986) |
| Water Solubility |
195ug/L(25 ºC) |
| Merck |
3103 |
| BRN |
91396 |
| Henry's Law Constant |
27.6 at 5 °C, 63.2 at 15 °C, 82.9 at 20 °C, 97.7 at 25 °C, 217 at 35 °C:in 3% NaCl solution: 66.1
at 5 °C, 158 at 15 °C, 395 at 25 °C, 507 at 35 °C (gas stripping-GC, Cetin et al., 2006) |
| Exposure limits |
NIOSH REL: TWA 0.25 mg/m3, IDLH 50 mg/m3; OSHA PEL: TWA 0.25 mg/m3; ACGIH TLV: TWA 0.25 mg/m3. |
| Stability |
Stable. Breakdown product of aldrin in the environment. Incompatible with acids, active metals and strong oxidizing agents. |
| InChI |
1S/C12H8Cl6O/c13-8-9(14)11(16)5-3-1-2(6-7(3)19-6)4(5)10(8,15)12(11,17)18/h2-7H,1H2/t2-,3+,4+,5-,6-,7+,10+,11- |
| InChIKey |
DFBKLUNHFCTMDC-PICURKEMSA-N |
| SMILES |
[H][C@@]12O[C@]1([H])C3CC2[C@]4([H])[C@@]3([H])[C@]5(Cl)C(Cl)=C(Cl)[C@@]4(Cl)C5(Cl)Cl |
| IARC |
2A (Vol. 5, Sup 7, 117) 2019 |
| EPA Substance Registry System |
Dieldrin (60-57-1) |