| Melting point |
225-229 °C |
| alpha |
D20 -47°; D27 -42° |
| Boiling point |
394.4°C (rough estimate) |
| Density |
1.2938 (rough estimate) |
| refractive index |
1.7610 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility |
Soluble in DMSO (up to 25 mg/ml). |
| form |
Powder |
| pka |
13+-.0.60(Predicted) |
| color |
White to Off-white |
| biological source |
Cordyceps militaris |
| λmax |
260nm(EtOH)(lit.) |
| Merck |
14,2529 |
| BRN |
35194 |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20° for up to 3 months. |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING |
| InChI |
1S/C10H13N5O3/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(17)1-5(2-16)18-10/h3-6,10,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,10+/m0/s1 |
| InChIKey |
OFEZSBMBBKLLBJ-BAJZRUMYSA-N |
| SMILES |
Nc1ncnc2n(cnc12)[C@@H]3O[C@H](CO)C[C@H]3O |
| CAS DataBase Reference |
73-03-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Adenosine, 3'-deoxy- (73-03-0) |