| Melting point |
>300 °C (dec.)(lit.) |
| storage temp. |
room temp |
| solubility |
Soluble in water, ethanol |
| Colour Index |
51180 |
| form |
Powder |
| color |
Dark green to black |
| PH Range |
10.1(BLUE)-11.1(RED) |
| Water Solubility |
Soluble in ethanol, and water (50 g/L) at 25°C. |
| λmax |
633 nm |
| Biological Applications |
Detecting microorganisms; treating virus infectious diseases; photodynamic therapy |
| Major Application |
diagnostic assay manufacturing
hematology
histology |
| InChI |
InChI=1S/C20H20N3O.H2O4S/c1-3-23(4-2)13-9-10-17-18(11-13)24-19-12-16(21)14-7-5-6-8-15(14)20(19)22-17;1-5(2,3)4/h5-12H,3-4,21H2,1-2H3;(H2,1,2,3,4)/q+1;/p-2 |
| InChIKey |
MMYKGGIXVBGGSZ-UHFFFAOYSA-L |
| SMILES |
NC1C=C2[O+]=C3C=C(N(CC)CC)C=CC3=NC2=C2C=CC=CC=12.S([O-])([O-])(=O)=O |
