| Boiling point |
591.36°C (rough estimate) |
| Density |
1.3224 (rough estimate) |
| bulk density |
900-1000kg/m3 |
| refractive index |
1.5800 (estimate) |
| storage temp. |
room temp |
| solubility |
Insoluble in water, benzene, chloroform,
ether; soluble in ethanol, acetone, acetic acid; soluble in
aqueous alkali |
| form |
Powder |
| pka |
4.0, 6.9, 13.4(at 25℃) |
| color |
Dark brown to brown-black |
| biological source |
synthetic |
| Water Solubility |
Soluble in acetone, alcohol, acetic acid (red color), and dilute aqueous alkali (blue-violet color). Insoluble in water. |
| λmax |
575 nm |
| Merck |
14,6863 |
| Stability |
Stable. |
| Biological Applications |
Diagnosis of liver biopsy; detecting Candida,hepatitis B surface antigen in fixed tissues,histamines,HBsAg in liver cell,microorganisms |
| Major Application |
diagnostic assay manufacturing
hematology
histology |
| InChI |
1S/C28H24N2O7/c1-11-5-15(31)7-17(33)25(11)29-27-13(3)23-21(9-19(27)35)37-22-10-20(36)28(14(4)24(22)23)30-26-12(2)6-16(32)8-18(26)34/h5-10,29-34H,1-4H3 |
| InChIKey |
VPEASJIRGSVXBF-UHFFFAOYSA-N |
| SMILES |
N(c5c(cc(cc5C)O)O)C1=C(c2[c]([o][c]3c2C(=C(C(=O)C=3)Nc4c(cc(cc4C)O)O)C)=CC1=O)C |
| EPA Substance Registry System |
Orcein (1400-62-0) |
