| Melting point |
194℃ |
| Boiling point |
194 °C (lit.) |
| Density |
1.004 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.44(lit.) |
| Flash point |
113 °C |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| form |
Liquid |
| pka |
11.13±0.46(Predicted) |
| color |
Colorless to Light yellow to Light orange |
| optical activity |
[α]20/D 22°, c = 1 in methanol |
| Major Application |
peptide synthesis |
| InChI |
1S/C11H21NO4/c1-7(2)8(9(13)15-6)12-10(14)16-11(3,4)5/h7-8H,1-6H3,(H,12,14)/t8-/m0/s1 |
| InChIKey |
XCJLIYKAMLUDGN-QMMMGPOBSA-N |
| SMILES |
COC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C |