| Melting point |
80-82 °C(lit.) |
| alpha |
-8.5 º (c=1, acetic acid) |
| Boiling point |
360.05°C (rough estimate) |
| Density |
1.2470 (rough estimate) |
| refractive index |
-7 ° (C=1, AcOH) |
| storage temp. |
-20°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| pka |
3.60±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]20/D 8.5±1°, c = 1% in acetic acid |
| BRN |
2331474 |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C9H17NO5/c1-5(11)6(7(12)13)10-8(14)15-9(2,3)4/h5-6,11H,1-4H3,(H,10,14)(H,12,13)/t5-,6+/m1/s1 |
| InChIKey |
LLHOYOCAAURYRL-RITPCOANSA-N |
| SMILES |
C(O)(=O)[C@H]([C@H](O)C)NC(OC(C)(C)C)=O |
| CAS DataBase Reference |
2592-18-9(CAS DataBase Reference) |