| Boiling point |
256.5±7.0 °C(Predicted) |
| Density |
0.951 g/mL at 20 °C (lit.) |
| refractive index |
n20/D 1.508 |
| Flash point |
114 °C |
| storage temp. |
2-8°C |
| form |
liquid |
| optical activity |
[α]20/D 79±2°, neat |
| Henry's Law Constant |
2.9×10-4 mol/(m3Pa) at 25℃, Copolovici and Niinemets (2015) |
| Stability |
Stable. Keep cool. Store under argon. Photosensitive, protect from light. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
1S/C15H24/c1-11-6-5-8-14(4)12-7-9-15(11,14)10-13(12,2)3/h6,12H,5,7-10H2,1-4H3/t12,14-,15+/m0/s1 |
| InChIKey |
ZCJQJJWNFDNQGZ-JQXSQYPDSA-N |
| SMILES |
CC1=CCC[C@@]2(C)C3CC[C@@]12CC3(C)C |
