| alpha |
-88 º(c=10%, EtOH) |
| Boiling point |
261-262 °C(lit.) |
| Density |
0.932 g/mL at 20 °C(lit.) |
| refractive index |
n20/D 1.498 |
| Flash point |
104°C |
| storage temp. |
2-8°C |
| solubility |
Chloroform (Soluble), DMSO (Slightly, Heated), Ethanol (Very Slightly), Methanol |
| form |
Oil |
| color |
Colourless to Light Yellow |
| Odor |
at 100.00 %. woody cedar sweet fresh |
| Odor Type |
woody |
| optical activity |
[α]20/D 88±1°, c = 10% in ethanol |
| BRN |
3196861 |
| Henry's Law Constant |
2.8×10-4 mol/(m3Pa) at 25℃, Copolovici and Niinemets (2015) |
| Dielectric constant |
3.2(24℃) |
| Cosmetics Ingredients Functions |
PERFUMING |
| InChI |
1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h7,11-13H,5-6,8-9H2,1-4H3/t11-,12+,13+,15+/m1/s1 |
| InChIKey |
IRAQOCYXUMOFCW-OSFYFWSMSA-N |
| SMILES |
C[C@@H]1CC[C@H]2C(C)(C)[C@H]3C[C@@]12CC=C3C |
| LogP |
6.308 (est) |
| CAS DataBase Reference |
469-61-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
1H-3a,7-methanoazulene, 2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-, [3r-(3«alpha»,3a«beta»,7«beta»,8a«alpha»)]-(469-61-4) |
| EPA Substance Registry System |
1H-3a,7-Methanoazulene, 2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-, (3R,3aS,7S,8aS)- (469-61-4) |