| Melting point |
134-135°C |
| Flash point |
9℃ |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Soluble in water, freely soluble in ethanol (96 per cent), in methanol and in methylene chloride. |
| form |
Solid |
| color |
White to Off-White |
| λmax |
261nm(lit.) |
| Merck |
14,1443 |
| Stability |
Hygroscopic |
| InChI |
InChI=1S/C16H19BrN2.C4H4O4/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13;5-3(6)1-2-4(7)8/h3-9,11,15H,10,12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey |
SRGKFVAASLQVBO-BTJKTKAUSA-N |
| SMILES |
C(C1=CC=C(Br)C=C1)(C1=NC=CC=C1)CCN(C)C.C(O)(=O)/C=C\C(O)=O |
| LogP |
3.565 (est) |
| CAS DataBase Reference |
980-71-2(CAS DataBase Reference) |
| EPA Substance Registry System |
2-Pyridinepropanamine, .gamma.-(4-bromophenyl)-N,N-dimethyl-, (2Z)-2-butenedioate (1:1) (980-71-2) |
