Melting point |
57-58 °C |
Boiling point |
606.7±55.0 °C(Predicted) |
Density |
1.562±0.06 g/cm3(Predicted) |
storage temp. |
-20°C |
solubility |
H2O: 0.1 M at 20 °C, clear to slightly hazy, colorless to faint yellow-green |
pka |
12.92±0.70(Predicted) |
form |
Solid |
color |
White to Pale Grey |
optical activity |
-67.102° (c=1.00 g/100ml, MEOH) |
Water Solubility |
H2O: 0.1M, clear to slightly hazy |
λmax |
280nm(DMSO)(lit.) |
Merck |
14,4942 |
Stability |
Hygroscopic |
InChI |
InChI=1/C14H17NO6/c16-6-10-11(17)12(18)13(19)14(21-10)20-9-5-15-8-4-2-1-3-7(8)9/h1-5,10-19H,6H2/t10-,11-,12+,13-,14-/s3 |
InChIKey |
XVARCVCWNFACQC-JOAVLQHANA-N |
SMILES |
O([C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)C1=CNC2C=CC=CC1=2 |&1:1,2,3,5,7,r| |
CAS DataBase Reference |
487-60-5 |