| Melting point |
158-162 °C |
| Boiling point |
499.4±45.0 °C(Predicted) |
| Density |
1.2135 (rough estimate) |
| refractive index |
1.6800 (estimate) |
| storage temp. |
Store at RT |
| solubility |
ethanol: 50 mg/mL, clear, yellow-green |
| pka |
4.5(at 25℃) |
| form |
White to off-white powder |
| color |
White to Light yellow to Light orange |
| biological source |
synthetic |
| Water Solubility |
Soluble in acetone (40 mg/mL - clear, yellow solution), ethanol (20 mg/mL), ether, castor oil; Soluble in chloroform (50 mg/mL - clear, yellow, extremely viscous solution); decomposed by strong alkali but stable in neutral or slightly acidic media; insoluble in water. |
| Sensitive |
Light Sensitive |
| Merck |
14,4968 |
| BRN |
497341 |
| BCS Class |
2 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
1S/C19H16ClNO4/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,22,23) |
| InChIKey |
CGIGDMFJXJATDK-UHFFFAOYSA-N |
| SMILES |
COc1ccc2n(c(C)c(CC(O)=O)c2c1)C(=O)c3ccc(Cl)cc3 |
| CAS DataBase Reference |
53-86-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
Indomethacin(53-86-1) |
| EPA Substance Registry System |
Indomethacin (53-86-1) |