| Melting point |
6 °C |
| Boiling point |
142 °C(lit.) |
| Density |
1.93 g/mL at 25 °C(lit.) |
| vapor pressure |
12.8-72hPa at 25-65℃ |
| refractive index |
n20/D 1.305(lit.) |
| Flash point |
141-143°C |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Soluble in DMSO |
| form |
Viscous Solution |
| Specific Gravity |
1.930 |
| color |
Colorless to tan |
| Water Solubility |
Not miscible or difficult to mix in water. |
| Merck |
14,7156 |
| BRN |
2016022 |
| Cosmetics Ingredients Functions |
SOLVENT |
| InChI |
1S/C8BrF17/c9-7(22,23)5(18,19)3(14,15)1(10,11)2(12,13)4(16,17)6(20,21)8(24,25)26 |
| InChIKey |
WTWWXOGTJWMJHI-UHFFFAOYSA-N |
| SMILES |
FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
| LogP |
6.1 at 25℃ |
| CAS DataBase Reference |
423-55-2(CAS DataBase Reference) |
| EPA Substance Registry System |
1-Bromoheptadecafluorooctane (423-55-2) |
