| Boiling point |
40 °C |
| Density |
0.967 g/mL at 25 °C(lit.) |
| vapor pressure |
23 hPa (195 °C) |
| refractive index |
1.4390 |
| Flash point |
82 °F |
| storage temp. |
Store below +30°C. |
| solubility |
Miscible with alcohol, isopropyl alcohol and toluene. |
| form |
Oily Liquid |
| Specific Gravity |
0.9671 |
| color |
Light yellow |
| explosive limit |
1.7-9.8%(V) |
| Water Solubility |
decomposes |
| Sensitive |
Moisture Sensitive |
| Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
| BRN |
3910908 |
| Stability |
Stability Stable, but may decompose upon exposure to air and moisture. Flammable. Incompatible with strong oxidizing agents, strong acids, water. |
| Cosmetics Ingredients Functions |
LIGHT STABILIZER |
| InChI |
1S/3C4H9O.Al/c3*1-3-4(2)5;/h3*4H,3H2,1-2H3;/q3*-1;+3 |
| InChIKey |
WOZZOSDBXABUFO-UHFFFAOYSA-N |
| SMILES |
CCC(C)O[Al](OC(C)CC)OC(C)CC |
| CAS DataBase Reference |
2269-22-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
Aluminum tri-sec-butoxide(2269-22-9) |
| EPA Substance Registry System |
2-Butanol, aluminum salt (2269-22-9) |