Melting point |
134-137 °C(lit.) |
Boiling point |
248.14°C (rough estimate) |
Density |
1.0825 (rough estimate) |
refractive index |
1.4440 (estimate) |
storage temp. |
Sealed in dry,Room Temperature |
solubility |
acetone: soluble0.25g/10 mL, clear, colorless to deep brown-yellow |
form |
powder to crystal |
pka |
11.62±0.20(Predicted) |
color |
White to Light yellow to Light orange |
BRN |
383995 |
InChI |
InChI=1S/C10H8O4/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6,9,11H |
InChIKey |
MIJRFWVFNKQQDK-UHFFFAOYSA-N |
SMILES |
C(=O)(C1=CC=CO1)C(C1=CC=CO1)O |
CAS DataBase Reference |
552-86-3(CAS DataBase Reference) |
NIST Chemistry Reference |
Ethanone, 1,2-di-2-furanyl-2-hydroxy-(552-86-3) |
EPA Substance Registry System |
Ethanone, 1,2-di-2-furanyl-2-hydroxy- (552-86-3) |