| Melting point |
175-178 °C (dec.)(lit.) |
| Boiling point |
518.67°C (rough estimate) |
| alpha |
-118 º (c=2.5 in chloroform) |
| Density |
1.2119 (rough estimate) |
| bulk density |
230kg/m3 |
| refractive index |
1.6300 (estimate) |
| storage temp. |
Store at RT |
| solubility |
>15.6mg/mL in DMSO |
| pka |
8.28(at 25℃) |
| form |
Powder |
| color |
White to light beige |
| Water Solubility |
Soluble in alcohol, chloroform, and benzene, slightly soluble in water, ether, and glycerol |
| Merck |
14,1455 |
| Henry's Law Constant |
4.7×1010 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| Cosmetic Ingredient Review (CIR) |
10,11-Dimethoxystrychnine (357-57-3) |
| InChIKey |
RRKTZKIUPZVBMF-PLNGPGDESA-N |
| SMILES |
N21[C@@H]3[C@@]4(C5N(c7c4cc(c(c7)OC)OC)C(=O)CC6OCC=C([C@@H]([C@@H]65)C3)C2)CC1 |
| LogP |
0.980 |
| CAS DataBase Reference |
357-57-3(CAS DataBase Reference) |
| NIST Chemistry Reference |
Brucine(357-57-3) |
| EPA Substance Registry System |
Brucine (357-57-3) |
