
| CAS: | 899821-23-9 |
| MF: | C16H19ClN2O |
| MW: | 290.79 |
| EINECS: | 200-510-5 |
| Product Categories: | 899821-23-9 |
| Mol File: | 899821-23-9.mol |
 |
|
| ACP-105 Chemical Properties |
| Melting point | 160 °C |
| Boiling point | 479.8±45.0 °C(Predicted) |
| density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.78±0.20(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1/C16H19ClN2O/c1-10-14(6-3-11(9-18)15(10)17)19-12-4-5-13(19)8-16(2,20)7-12/h3,6,12-13,20H,4-5,7-8H2,1-2H3/t12-,13+,16+ |
| InChIKey | OUEODVPKPRQETQ-VIKVFOODNA-N |
| SMILES | CC1C(=C(C#N)C=CC=1N1[C@@H]2C[C@](O)(C)C[C@H]1CC2)Cl |&1:10,12,16,r| |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.