1. Product information
| Product Name: | TLB 150 Benzoate |
| Synonyms: | TLB 150 Benzoate;TLB-150,RAD-150;Benzonitrile, 4-[[(1R,2S)-2-(benzoyloxy)-1-[5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl]propyl]amino]-2-chloro-3-methyl-;RAD 140 replacement TLB 150 benzoate powder;TLB 150;Testolone Acetate;RAD-140 Acetate;(1R,2S)-1-(3-Chloro-4-cyano-2-methylphenylamino)-1-(5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl)propan-2-yl benzoate |
| CAS: | 1208070-53-4 |
| MF: | C27H20ClN5O3 |
| MW: | 497.93 |
| EINECS: | 1592732-453-0 |
| Product Categories: | 1208070-53-4 |
| Mol File: | 1208070-53-4.mol |
 |
|
| TLB 150 Benzoate Chemical Properties |
| Boiling point | 743.0±70.0 °C(Predicted) |
| density | 1.38±0.1 g/cm3(Predicted) |
| pka | -2.86±0.50(Predicted) |
| InChIKey | NQUKIBBKKLFEQU-BXKMTCNYSA-N |
| SMILES | C(#N)C1=CC=C(N[C@@H](C2=NN=C(C3=CC=C(C#N)C=C3)O2)[C@@H](OC(=O)C2=CC=CC=C2)C)C(C)=C1Cl |
|
| TLB 150 Benzoate Usage And Synthesis |
| Uses | TLB 150 Benzoate is a heterocyclic organic compound which can be used as intermediate of synthetic materials. |
2. Packaging
For powders: normal is 25kgs/Drum or bag, or larger/smaller package as request.
For liquids: normal 25kgs/drum, 180-300kgs/bucket, or IBC, determined by the nature of the product.
Or smaller package 1kg/bottle, 10kgs/bottle as request.


3. Shipping

4. Contact information
For more details, pls contact us freely.
Email address : elin@fdachem.com
Mob: 86 13613820652
WhatsApp/Skype/Wechat/LINE: 86 13613820652
