| CAS: | 50847-11-5 |
| MF: | C14H18N2O |
| MW: | 230.31 |
| EINECS: | 637-150-7 |
| Product Categories: | Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals;Cyclic Nucleotide related;Amines;Heterocycles;API |
| Mol File: | 50847-11-5.mol |
 |
|
| Ibudilast Chemical Properties |
| Melting point | 53-54°C |
| Boiling point | 175°C/7.5mmHg(lit.) |
| density | 1.09 |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO: 28 mg/mL, soluble |
| form | solid |
| pka | 1.22±0.30(Predicted) |
| color | white |
| Merck | 14,4879 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 3 months. |
| InChI | InChI=1S/C14H18N2O/c1-9(2)13-12(14(17)10(3)4)11-7-5-6-8-16(11)15-13/h5-10H,1-4H3 |
| InChIKey | ZJVFLBOZORBYFE-UHFFFAOYSA-N |
| SMILES | C(C1=C2N(N=C1C(C)C)C=CC=C2)(=O)C(C)C |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T，USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.
China
