Synonyms
Tetrahydroxyadipic acid
Saccharolactic acid
Galactaric acid
Molecular Weight
210.14 g/mol
Smiles
[C@@H]([C@@H]([C@H](C(=O)O)O)O)([C@@H](C(=O)O)O)O
Mucic acid is a metal chelate that stimulates the metabolism of carbohydrates, fats and proteins. It also plays a role in the production of energy in the body. Mucic acid has been shown to have a protective effect against infectious diseases, as it activates toll-like receptor 2 (TLR2) and TLR4, which are molecules involved in innate immunity. Mucic acid has been shown to protect against influenza virus infection by increasing the expression of interferon-gamma (IFN-γ) and IL-12, which are cytokines that inhibit viral replication. Mucic acid can be used as a fluorescence probe for detection of polymorphonuclear leucocytes in blood samples.
Canada
