| CAS: | 330784-47-9 |
| MF: | C23H26ClN7O3 |
| MW: | 483.95 |
| EINECS: | 000-000-0 |
| Product Categories: | Avanafil;Inhibitor;Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals;API;Chiral Reagents;Heterocycles;Inhibitors;330784-47-9 |
| Mol File: | 330784-47-9.mol |
 |
|
| Avanafil Chemical Properties |
| Melting point | 150-152°C |
| density | 1.372 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 11.84±0.46(Predicted) |
| color | White to Off-White |
| InChIKey | WEAJZXNPAWBCOA-INIZCTEOSA-N |
| SMILES | C1(N2CCC[C@H]2CO)=NC=C(C(NCC2=NC=CC=N2)=O)C(NCC2=CC=C(OC)C(Cl)=C2)=N1 |
| CAS DataBase Reference | 330784-47-9(CAS DataBase Reference) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T，USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.
China
