
| CAS: | 17270-12-1 |
| MF: | C15H11ClN2O2 |
| MW: | 286.71 |
| EINECS: | 200-838-9 |
| Product Categories: |
|
| Mol File: | 17270-12-1.mol |
 |
|
| 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-5-(4-hydroxyphenyl)- Chemical Properties |
| Melting point | 271-272 °C |
| Boiling point | 509.9±50.0 °C(Predicted) |
| density | 1.42±0.1 g/cm3(Predicted) |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 9.05±0.30(Predicted) |
| form | Solid |
| color | Light Yellow to Light Beige |
| InChI | InChI=1S/C15H11ClN2O2/c16-10-3-6-13-12(7-10)15(17-8-14(20)18-13)9-1-4-11(19)5-2-9/h1-7,19H,8H2,(H,18,20) |
| InChIKey | WVHIBVZUJQMFON-UHFFFAOYSA-N |
| SMILES | N1C2=CC=C(Cl)C=C2C(C2=CC=C(O)C=C2)=NCC1=O |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.