CAS: | 870888-46-3 |
MF: | C18H18N2O |
MW: | 278.36 |
EINECS: | 870888-460-3 |
Product Categories: | 870888-46-3 |
Mol File: | 870888-46-3.mol |
|
|
AC-262536 Chemical Properties |
Melting point | 158-162°C |
Boiling point | 526.0±45.0 °C(Predicted) |
density | 1.28±0.1 g/cm3(Predicted) |
storage temp. | 2-8°C |
solubility | DMSO: Soluble |
pka | 14.73±0.20(Predicted) |
InChI | InChI=1/C18H18N2O/c19-11-12-5-8-18(17-4-2-1-3-16(12)17)20-13-6-7-14(20)10-15(21)9-13/h1-5,8,13-15,21H,6-7,9-10H2/t13-,14+,15+ |
InChIKey | ATKWLNSCJYLXPF-FICVDOATNA-N |
SMILES | O[C@H]1C[C@H]2CC[C@H](N2C2=CC=C(C#N)C3C=CC=CC2=3)C1 |&1:1,3,6,r| |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.