1. Product information
| Product Name: | 4-BROMODIBENZOFURAN |
| Synonyms: | 4-BROMODIBENZOFURAN;4-BROMO-DIBENZOURAN;4-Bromodibenzo[b,d]furan;Dibenzofuran, 4-bromo-;4-Bromo-dibenzofuran 97%;4-Bromodibenzofuran >;DBF-Br;Tianfu chem 4-BROMODIBENZOFURAN |
| CAS: | 89827-45-2 |
| MF: | C12H7BrO |
| MW: | 247.09 |
| EINECS: |
|
| Product Categories: |
|
| Mol File: | Mol File |
 |
|
| 4-BROMODIBENZOFURAN Chemical Properties |
| Melting point | 67-69℃ |
| Boiling point | 220 °C(Press: 40 Torr) |
| density | 1.577 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C12H7BrO/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7H |
| InChIKey | DYTYBRPMNQQFFL-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2C2=CC=CC(Br)=C12 |
| CAS DataBase Reference | 89827-45-2 |
| Hazard Codes | Xn |
| Risk Statements | 22-36-53 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29329990 |
|
| 4-BROMODIBENZOFURAN Usage And Synthesis |
| Chemical Properties | White Crysstalline |
| Uses | Versatile scaffold to get entry to 4-substituted dibenzofuranes. Substituted dibenzofuranes have utility in semiconductors and OLED applications. |
2. Packaging
For powders: normal is 25kgs/Drum or bag, or larger/smaller package as request.
For liquids: normal 25kgs/drum, 180-300kgs/bucket, or IBC, determined by the nature of the product.
Or smaller package 1kg/bottle, 10kgs/bottle as request.
3. Shipping
4. Contact information
For more details, pls contact us freely.
Email address : elin@fdachem.com
Mob: 86 13613820652
WhatsApp/Skype/Wechat/LINE: 86 13613820652
China
