1. Product information
| Product Name: | 3-Bromodibenzofuran |
| Synonyms: | NSC 167387;3-Bromodibenzofura;Dibenzofuran, 3-bromo-;DBF-Brb;3-DBFBA-C;TIANFU CHEM---Dibenzofuran, 3-bromo-;3-Bromo dibenzofurane;3-bromodibenzofuran |
| CAS: | 26608-06-0 |
| MF: | C12H7BrO |
| MW: | 247.09 |
| EINECS: |
|
| Product Categories: | OLED |
| Mol File: | 26608-06-0.mol |
 |
|
| 3-Bromodibenzofuran Chemical Properties |
| Melting point | 232-233℃ |
| Boiling point | 343.8±15.0 °C(Predicted) |
| density | 1.4587 (rough estimate) |
| refractive index | 1.5290 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C12H7BrO/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7H |
| InChIKey | AZFABGHLDGJASW-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2C2=CC=C(Br)C=C12 |
| CAS DataBase Reference | 26608-06-0 |
|
| 3-Bromodibenzofuran Usage And Synthesis |
| Chemical Properties | 3-Bromodibenzofuran is a white crystal-Powder at 20°C. 3-Bromodibenzofuran can be used to synthesize a phosphorescent iridium complex containing a 3-phenylpyridazine structure. |
| Uses | 3-Bromodibenzo[b,d]furan is a useful research chemical. |
2. Packaging
For powders: normal is 25kgs/Drum or bag, or larger/smaller package as request.
For liquids: normal 25kgs/drum, 180-300kgs/bucket, or IBC, determined by the nature of the product.
Or smaller package 1kg/bottle, 10kgs/bottle as request.
3. Shipping
4. Contact information
For more details, pls contact us freely.
Email address : elin@fdachem.com
Mob: 86 13613820652
WhatsApp/Skype/Wechat/LINE: 86 13613820652
China
