2-Hydrazinobenzothiazole
- Product Name2-Hydrazinobenzothiazole
- CAS615-21-4
- MFC7H7N3S
- MW165.22
- EINECS210-416-6
- MOL File615-21-4.mol
Chemical Properties
| Melting point | 198-202 °C (lit.) |
| Boiling point | 352.4±25.0 °C(Predicted) |
| Density | 1.2404 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Solubility in hot methanol almost transparent. |
| form | powder to crystal |
| pka | 2.81±0.20(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H7N3S/c8-10-7-9-5-3-1-2-4-6(5)11-7/h1-4H,8H2,(H,9,10) |
| InChIKey | JYSUYJCLUODSLN-UHFFFAOYSA-N |
| SMILES | S1C2=CC=CC=C2N=C1NN |
| CAS DataBase Reference | 615-21-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2(3H)-Benzothiazolone, hydrazone (615-21-4) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DL4725000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29342000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |
