(3R)-(+)-1-Benzyl-3-(tert-butoxycarbonylamino)pyrrolidine
- Product Name(3R)-(+)-1-Benzyl-3-(tert-butoxycarbonylamino)pyrrolidine
- CAS131878-23-4
- MFC16H24N2O2
- MW276.37
- EINECS
- MOL File131878-23-4.mol
Chemical Properties
| Melting point | 77-81 °C(lit.) |
| Boiling point | 385.1±31.0 °C(Predicted) |
| Density | 1.08 |
| refractive index | 18.5 ° (C=2, EtOH) |
| storage temp. | 2-8°C |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 12.31±0.20(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D +6°, c = 1% in chloroform |
| InChI | 1S/C16H24N2O2/c1-16(2,3)20-15(19)17-14-9-10-18(12-14)11-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H,17,19)/t14-/m1/s1 |
| InChIKey | PHOIDJGLYWEUEK-CQSZACIVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(C1)Cc2ccccc2 |
| CAS DataBase Reference | 131878-23-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |