2-Methylglutaric Acid
- Product Name2-Methylglutaric Acid
- CAS617-62-9
- MFC6H10O4
- MW146.14
- EINECS210-521-7
- MOL File617-62-9.mol
Chemical Properties
| Melting point | 80-82 °C(lit.) |
| Boiling point | 214-215 °C22 mm Hg(lit.) |
| Density | 1.246 |
| vapor pressure | 0.001Pa at 20℃ |
| Flash point | 149℃ |
| storage temp. | Store below +30°C. |
| solubility | DMF: 20 mg/ml; DMSO: 16 mg/ml; Ethanol: Slightly soluble; PBS (pH 7.2): 10 mg/ml |
| pka | 4.57±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C6H10O4/c1-4(6(9)10)2-3-5(7)8/h4H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | AQYCMVICBNBXNA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(C)CCC(O)=O |
| LogP | -1.3 at 20℃ |
| EPA Substance Registry System | 2-Methylglutaric acid (617-62-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2917198090 |
