Solvent Orange 63
- Product NameSolvent Orange 63
- CAS16294-75-0
- MFC23H12OS
- MW336.41
- EINECS240-385-4
- MOL File16294-75-0.mol
Chemical Properties
| Boiling point | 607.8±25.0 °C(Predicted) |
| Density | 1.417±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| Appearance | Brown to red Solid |
| InChI | InChI=1S/C23H12OS/c24-23-17-7-2-1-5-13(17)15-11-12-20-22-16(9-10-18(23)21(15)22)14-6-3-4-8-19(14)25-20/h1-12H |
| InChIKey | NVNWZZLOQBHTCW-UHFFFAOYSA-N |
| SMILES | C12=CC=C3C4=C(C5=C(C=CC=C5)C3=O)C=CC(SC3=C1C=CC=C3)=C24 |
| LogP | 3.6 at 24℃ and pH7 |
| CAS DataBase Reference | 16294-75-0(CAS DataBase Reference) |
| EPA Substance Registry System | 14H-Anthra[2,1,9-mna]thioxanthen-14-one (16294-75-0) |
