(R)-(+)-Citronellic acid
- Product Name(R)-(+)-Citronellic acid
- CAS18951-85-4
- MFC10H18O2
- MW170.25
- EINECS
- MOL File18951-85-4.mol
Chemical Properties
| Boiling point | 119 °C/3 mmHg (lit.) |
| Density | 0.926 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ether, Ethyl Acetate, Methanol (Slightly) |
| pka | 4.78±0.10(Predicted) |
| form | Oil |
| color | Clear Pale Yellow to Pale Brown |
| optical activity | [α]25/D +8°, neat |
| JECFA Number | 1221 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C10H18O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H,11,12)/t9-/m1/s1 |
| InChIKey | GJWSUKYXUMVMGX-SECBINFHSA-N |
| SMILES | C[C@H](CC\C=C(/C)C)CC(O)=O |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 21-38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 2916199590 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Skin Irrit. 2 |
