3-Chloro-6-methoxypyridazine
- Product Name3-Chloro-6-methoxypyridazine
- CAS1722-10-7
- MFC5H5ClN2O
- MW144.56
- EINECS217-019-7
- MOL File1722-10-7.mol
Chemical Properties
| Melting point | 84-85 °C(lit.) |
| Boiling point | 285℃ |
| Density | 1.292 |
| Flash point | 126℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 0.74±0.10(Predicted) |
| color | White to Almost white |
| BRN | 118854 |
| InChI | InChI=1S/C5H5ClN2O/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3 |
| InChIKey | XBJLKXOOHLLTPG-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NN=C(OC)C=C1 |
| CAS DataBase Reference | 1722-10-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |