| Melting point |
>300 °C (lit.) |
| Boiling point |
203.0±19.0 °C(Predicted) |
| Density |
1.506±0.06 g/cm3(Predicted) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| form |
Powder |
| pka |
10.75±0.30(Predicted) |
| Appearance |
Light yellow to yellow Solid |
| Water Solubility |
Insoluble in water. |
| BRN |
171386 |
| InChI |
InChI=1S/C7H5N3O3/c11-7-8-5-2-1-4(10(12)13)3-6(5)9-7/h1-3H,(H2,8,9,11) |
| InChIKey |
DLJZIPVEVJOKHB-UHFFFAOYSA-N |
| SMILES |
C1(=O)NC2=CC=C([N+]([O-])=O)C=C2N1 |
| LogP |
1.35 at 23℃ and pH6.5-7.5 |
| CAS DataBase Reference |
93-84-5(CAS DataBase Reference) |
| EPA Substance Registry System |
2H-Benzimidazol-2-one, 1,3-dihydro-5-nitro- (93-84-5) |
