| Melting point |
80-83 °C (lit.) |
| Boiling point |
259.7±23.0 °C(Predicted) |
| Density |
1.9815 (estimate) |
| storage temp. |
2-8°C, protect from light |
| pka |
pK1:4.08 (25°C) |
| form |
powder to crystal |
| color |
White to Light yellow to Light orange |
| Water Solubility |
74.3g/L(25 ºC) |
| Sensitive |
Light Sensitive |
| BRN |
1699514 |
| InChI |
InChI=1S/C3H5IO2/c4-2-1-3(5)6/h1-2H2,(H,5,6) |
| InChIKey |
KMRNTNDWADEIIX-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)CCI |
| CAS DataBase Reference |
141-76-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Propanoic acid, 3-iodo- (141-76-4) |
