4-Acetamido-2-methylbenzoic acid
- Product Name4-Acetamido-2-methylbenzoic acid
- CAS103204-69-9
- MFC10H11NO3
- MW193.2
- EINECS
- MOL File103204-69-9.mol
Chemical Properties
| Melting point | 237-242 °C (lit.) |
| Boiling point | 421.9±33.0 °C(Predicted) |
| Density | 1.276±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.04±0.25(Predicted) |
| color | White to Yellow |
| Major Application | peptide synthesis |
| InChI | 1S/C10H11NO3/c1-6-5-8(11-7(2)12)3-4-9(6)10(13)14/h3-5H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | AQPDTYYKDYMCTH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(O)=O)c(C)c1 |
Safety Information
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2918999090 |
| Storage Class | 13 - Non Combustible Solids |