Chemical Properties
| Melting point | 252-254 °C(lit.) |
| Boiling point | 448 °C(lit.) |
| storage temp. | room temp |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-white to light yellow |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. Protect from moisture. |
| InChI | 1S/C18H12/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D |
| InChIKey | WDECIBYCCFPHNR-AQZSQYOVSA-N |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c([2H])c([2H])c3c4c([2H])c([2H])c([2H])c([2H])c4c([2H])c([2H])c23 |
| EPA Substance Registry System | Chrysene-d12 (1719-03-5) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 45-50/53-68-67-52/53-36/37/38 |
| Safety Statements | 53-45-60-61-26 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Muta. 2 |
