o-Xylylenebis(triphenylphosphonium bromide)
- Product Nameo-Xylylenebis(triphenylphosphonium bromide)
- CAS1519-46-6
- MFC44H38BrP2+
- MW708.64
- EINECS216-183-7
- MOL File1519-46-6.mol
Chemical Properties
| Melting point | >300 °C (lit.) |
| storage temp. | Store at room temperature, keep dry and cool |
| Appearance | White to off-white Solid |
| Sensitive | Hygroscopic |
| BRN | 4121635 |
| InChIKey | MXCBXCYGWQAOSN-UHFFFAOYSA-L |
| SMILES | [Br-].[Br-].C(c1ccccc1C[P+](c2ccccc2)(c3ccccc3)c4ccccc4)[P+](c5ccccc5)(c6ccccc6)c7ccccc7 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3278 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |